ChemNet > CAS > 5467-72-1 4-Bromophenacylamine hydrochloride
5467-72-1 4-Bromophenacylamine hydrochloride
| Naam product |
4-Bromophenacylamine hydrochloride |
| Engelse naam |
4-Bromophenacylamine hydrochloride; 2-Amino-4'-Bromoacetophenone Hydrochloride; 2-Amino-4'-bromoacetophenone HCl |
| MF |
C8H8BrNO |
| Molecuulgewicht |
214.0592 |
| InChI |
InChI=1/C8H8BrNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4H,5,10H2 |
| CAS-nummer |
5467-72-1 |
| EINECS |
226-778-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.52g/cm3 |
| Smeltpunt |
265℃ |
| Kookpunt |
322.8°C at 760 mmHg |
| Brekingsindex |
1.589 |
| Vlampunt |
149°C |
| Dampdruk |
0.000272mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|