ChemNet > CAS > 220141-71-9 3,5-Difluorobenzylchloride
220141-71-9 3,5-Difluorobenzylchloride
| Ονομασία του προϊόντος |
3,5-Difluorobenzylchloride |
| Συνώνυμα |
3,5-Difluorobenzyl chloride; 1-(chloromethyl)-3,5-difluorobenzene |
| MF |
C7H5ClF2 |
| Μοριακό βάρος |
162.5644 |
| InChI |
InChI=1/C7H5ClF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 |
| CAS ΟΧΙ |
220141-71-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.294g/cm3 |
| Σημείο βρασμού |
164.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.485 |
| Σημείο ανάφλεξης |
56.2°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
