ChemNet > CAS > 97480-60-9 3,5-Dimethylphenylthiourea
97480-60-9 3,5-Dimethylphenylthiourea
Ονομασία του προϊόντος |
3,5-Dimethylphenylthiourea |
Αγγλικό όνομα |
3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
MF |
C9H12N2S |
Μοριακό βάρος |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
CAS ΟΧΙ |
97480-60-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.2g/cm3 |
Σημείο βρασμού |
293.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.674 |
Σημείο ανάφλεξης |
131.5°C |
Πίεση ατμών |
0.00168mmHg at 25°C |
Κινδύνου Κώδικες |
R25:Toxic if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|