ChemNet > CAS > 97480-60-9 3,5-Dimethylphenylthiourea
97480-60-9 3,5-Dimethylphenylthiourea
Название продукта |
3,5-Dimethylphenylthiourea |
Английское название |
3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
Молекулярная формула |
C9H12N2S |
Молекулярный вес |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
Регистрационный номер CAS |
97480-60-9 |
Молекулярная структура |
|
Плотность |
1.2g/cm3 |
Точка кипения |
293.9°C at 760 mmHg |
Показатель преломления |
1.674 |
Температура вспышки |
131.5°C |
Давление пара |
0.00168mmHg at 25°C |
Риск коды |
R25:Toxic if swallowed.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|