ChemNet > CAS > 131738-73-3 1-Bromo-3-isopropoxybenzene
131738-73-3 1-Bromo-3-isopropoxybenzene
termék neve |
1-Bromo-3-isopropoxybenzene |
Angol név |
1-Bromo-3-isopropoxybenzene; 2-(3-Bromophenoxy)propane~3-Bromophenyl isopropyl ether; 3-Bromophenyl isopropyl ether; 1-bromo-3-(1-methylethoxy)benzene |
MF |
C9H11BrO |
Molekulatömeg |
215.087 |
InChI |
InChI=1/C9H11BrO/c1-7(2)11-9-5-3-4-8(10)6-9/h3-7H,1-2H3 |
CAS-szám |
131738-73-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.319g/cm3 |
Forráspont |
232°C at 760 mmHg |
Törésmutató |
1.523 |
Gyulladáspont |
104.2°C |
Gőznyomás |
0.0919mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|