ChemNet > CAS > 207981-48-4 2,3-difluorocinnamic acid
207981-48-4 2,3-difluorocinnamic acid
| termék neve |
2,3-difluorocinnamic acid |
| Angol név |
2,3-difluorocinnamic acid;(2E)-3-(2,3-difluorophenyl)prop-2-enoic acid; (2E)-3-(2,3-difluorophenyl)prop-2-enoate |
| MF |
C9H5F2O2 |
| Molekulatömeg |
183.1322 |
| InChI |
InChI=1/C9H6F2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
| CAS-szám |
207981-48-4 |
| Molekuláris szerkezete |
|
| Forráspont |
281.3°C at 760 mmHg |
| Gyulladáspont |
124°C |
| Gőznyomás |
0.0017mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|