ChemNet > CAS > 207981-48-4 2,3-difluorocinnamic acid
207981-48-4 2,3-difluorocinnamic acid
| 상품명칭 |
2,3-difluorocinnamic acid |
| 영문 이름 |
2,3-difluorocinnamic acid;(2E)-3-(2,3-difluorophenyl)prop-2-enoic acid; (2E)-3-(2,3-difluorophenyl)prop-2-enoate |
| 분자식 |
C9H5F2O2 |
| 분자량 |
183.1322 |
| InChI |
InChI=1/C9H6F2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
| cas번호 |
207981-48-4 |
| 분자 구조 |
|
| 비등점 |
281.3°C at 760 mmHg |
| 인화점 |
124°C |
| 증기압 |
0.0017mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|