ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| termék neve |
2-Iodophenylacetonitrile |
| Szinonimák |
2-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Molekulatömeg |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| CAS-szám |
40400-15-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.764g/cm3 |
| Forráspont |
306°C at 760 mmHg |
| Törésmutató |
1.624 |
| Gyulladáspont |
138.8°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
