ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| שם המוצר |
2-Iodophenylacetonitrile |
| נרדפות |
2-Iodobenzyl cyanide |
| מולקולרית פורמולה |
C8H6IN |
| משקל מולקולרי |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| מספר CAS |
40400-15-5 |
| מבנה מולקולרי |
|
| צפיפות |
1.764g/cm3 |
| נקודת רתיחה |
306°C at 760 mmHg |
| משקל סגולי |
1.624 |
| נקודת הבזק |
138.8°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|
