ChemNet > CAS > 579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
termék neve |
(4-Fluorophenyl)-(2-thienyl) ketone |
Angol név |
(4-Fluorophenyl)-(2-thienyl) ketone; (4-Fluorophenyl)-2-thienyl methanone; 4-Fluorophenyl-2-thienyl ketone; (4-fluorophenyl)(thiophen-2-yl)methanone |
MF |
C11H7FOS |
Molekulatömeg |
206.2361 |
InChI |
InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
CAS-szám |
579-49-7 |
EINECS |
209-442-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.279g/cm3 |
Olvadáspont |
94-99℃ |
Forráspont |
314.7°C at 760 mmHg |
Törésmutató |
1.59 |
Gyulladáspont |
144.1°C |
Gőznyomás |
0.000459mmHg at 25°C |
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|