ChemNet > CAS > 579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
نام محصول |
(4-Fluorophenyl)-(2-thienyl) ketone |
نام انگلیسی |
(4-Fluorophenyl)-(2-thienyl) ketone; (4-Fluorophenyl)-2-thienyl methanone; 4-Fluorophenyl-2-thienyl ketone; (4-fluorophenyl)(thiophen-2-yl)methanone |
میدان مغناطیسی |
C11H7FOS |
وزن مولکولی |
206.2361 |
InChI |
InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
شماره سیایاس |
579-49-7 |
تعداد کمیسیون اروپایی |
209-442-0 |
ساختار مولکولی |
|
تراکم |
1.279g/cm3 |
نقطه ذوب |
94-99℃ |
نقطه غلیان |
314.7°C at 760 mmHg |
ضریب شکست |
1.59 |
نقطه اشتعال |
144.1°C |
فشار بخار |
0.000459mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|