ChemNet > CAS > 10516-71-9 3-(3-methoxyphenyl)propionic acid
10516-71-9 3-(3-methoxyphenyl)propionic acid
Nama produk |
3-(3-methoxyphenyl)propionic acid |
Nama bahasa Inggris |
3-(3-methoxyphenyl)propionic acid; 3-Methoxyhydrocinnamic acid; 3-(3-methoxyphenyl)propanoic acid |
MF |
C10H12O3 |
Berat Molekul |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
CAS NO |
10516-71-9 |
EINECS |
234-049-6 |
Struktur Molekul |
|
Kepadatan |
1.144g/cm3 |
Titik lebur |
43-45℃ |
Titik didih |
318.1°C at 760 mmHg |
Indeks bias |
1.53 |
Titik nyala |
125.6°C |
Tekanan uap |
0.000155mmHg at 25°C |
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|