ChemNet > CAS > 10516-71-9 3-(3-methoxyphenyl)propionic acid
10516-71-9 3-(3-methoxyphenyl)propionic acid
اسم المنتج |
3-(3-methoxyphenyl)propionic acid |
الاسم بالانجليزية |
3-(3-methoxyphenyl)propionic acid; 3-Methoxyhydrocinnamic acid; 3-(3-methoxyphenyl)propanoic acid |
الصيغة الجزيئية |
C10H12O3 |
الوزن الجزيئي الغرامي |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
إستراتيجية المساعدة القطرية |
10516-71-9 |
المفوضية الأوروبية رقم |
234-049-6 |
بنية جزيئية |
|
كثافة |
1.144g/cm3 |
درجة الإنصهار |
43-45℃ |
نقطة الغليان |
318.1°C at 760 mmHg |
معامل الإنكسار |
1.53 |
نقطة الوميض |
125.6°C |
ضغط البخار |
0.000155mmHg at 25°C |
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|