ChemNet > CAS > 1948-40-9 3,5-Diiodo-4-hydroxybenzaldehyde
1948-40-9 3,5-Diiodo-4-hydroxybenzaldehyde
Nama produk |
3,5-Diiodo-4-hydroxybenzaldehyde |
Nama bahasa Inggris |
3,5-Diiodo-4-hydroxybenzaldehyde; 4-hydroxy-3,5-diiodobenzaldehyde |
MF |
C7H4I2O2 |
Berat Molekul |
373.9144 |
InChI |
InChI=1/C7H4I2O2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
CAS NO |
1948-40-9 |
EINECS |
217-754-3 |
Struktur Molekul |
|
Kepadatan |
2.602g/cm3 |
Titik didih |
284.1°C at 760 mmHg |
Indeks bias |
1.787 |
Titik nyala |
125.6°C |
Tekanan uap |
0.00177mmHg at 25°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|