ChemNet > CAS > 1948-40-9 3,5-Diiodo-4-hydroxybenzaldehyde
1948-40-9 3,5-Diiodo-4-hydroxybenzaldehyde
| نام محصول |
3,5-Diiodo-4-hydroxybenzaldehyde |
| مترادف |
4-hydroxy-3,5-diiodobenzaldehyde |
| میدان مغناطیسی |
C7H4I2O2 |
| وزن مولکولی |
373.9144 |
| InChI |
InChI=1/C7H4I2O2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
| شماره سیایاس |
1948-40-9 |
| تعداد کمیسیون اروپایی |
217-754-3 |
| ساختار مولکولی |
|
| تراکم |
2.602g/cm3 |
| نقطه غلیان |
284.1°C at 760 mmHg |
| ضریب شکست |
1.787 |
| نقطه اشتعال |
125.6°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
