ChemNet > CAS > 27339-38-4 3-Formylfuran-2-boronic acid
27339-38-4 3-Formylfuran-2-boronic acid
Nama produk |
3-Formylfuran-2-boronic acid |
Sinonim |
2-Borono-3-furaldehyde; (3-formylfuran-2-yl)boronic acid |
MF |
C5H5BO4 |
Berat Molekul |
139.9018 |
InChI |
InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
CAS NO |
27339-38-4 |
Struktur Molekul |
|
Kepadatan |
1.36g/cm3 |
Titik didih |
346.6°C at 760 mmHg |
Indeks bias |
1.51 |
Titik nyala |
163.4°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|