ChemNet > CAS > 27339-38-4 3-Formylfuran-2-boronic acid
27339-38-4 3-Formylfuran-2-boronic acid
상품명칭 |
3-Formylfuran-2-boronic acid |
영문 이름 |
3-Formylfuran-2-boronic acid; 2-Borono-3-furaldehyde; (3-formylfuran-2-yl)boronic acid |
분자식 |
C5H5BO4 |
분자량 |
139.9018 |
InChI |
InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
cas번호 |
27339-38-4 |
분자 구조 |
|
밀도 |
1.36g/cm3 |
비등점 |
346.6°C at 760 mmHg |
굴절 지수 |
1.51 |
인화점 |
163.4°C |
증기압 |
2.15E-05mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|