ChemNet > CAS > 598-88-9 1,2-dichloro-1,2-difluoroethylene
598-88-9 1,2-dichloro-1,2-difluoroethylene
| Nama produk |
1,2-dichloro-1,2-difluoroethylene |
| Nama bahasa Inggris |
1,2-dichloro-1,2-difluoroethylene;1,2-Dichloro-1,2-difluoroethylene; Ethene, 1,2-dichloro-1,2-difluoro-; 1,2-dichloro-1,2-difluoroethene; (Z)-1,2-dichloro-1,2-difluoroethene; (E)-1,2-dichloro-1,2-difluoroethene |
| MF |
C2Cl2F2 |
| Berat Molekul |
132.9242 |
| InChI |
InChI=1/C2Cl2F2/c3-1(5)2(4)6/b2-1+ |
| CAS NO |
598-88-9 |
| EINECS |
209-956-5 |
| Struktur Molekul |
|
| Kepadatan |
1.503g/cm3 |
| Titik didih |
22.8°C at 760 mmHg |
| Indeks bias |
1.392 |
| Tekanan uap |
821mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S9:Keep container in a well-ventilated place.;
|
|