ChemNet > CAS > 598-88-9 1,2-dichloro-1,2-difluoroethylene
598-88-9 1,2-dichloro-1,2-difluoroethylene
| 상품명칭 |
1,2-dichloro-1,2-difluoroethylene |
| 영문 이름 |
1,2-dichloro-1,2-difluoroethylene;1,2-Dichloro-1,2-difluoroethylene; Ethene, 1,2-dichloro-1,2-difluoro-; 1,2-dichloro-1,2-difluoroethene; (Z)-1,2-dichloro-1,2-difluoroethene; (E)-1,2-dichloro-1,2-difluoroethene |
| 분자식 |
C2Cl2F2 |
| 분자량 |
132.9242 |
| InChI |
InChI=1/C2Cl2F2/c3-1(5)2(4)6/b2-1+ |
| cas번호 |
598-88-9 |
| EC번호 |
209-956-5 |
| 분자 구조 |
|
| 밀도 |
1.503g/cm3 |
| 비등점 |
22.8°C at 760 mmHg |
| 굴절 지수 |
1.392 |
| 증기압 |
821mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S9:Keep container in a well-ventilated place.;
|
|