698-76-0 Octanolactone
Nama produk |
Octanolactone |
Nama bahasa Inggris |
Octanolactone; 5-Hydroxyoctanoic acid lactone; delta-Octalactone; 1,5-Octanolide; 6-propyltetrahydro-2H-pyran-2-one; Delta Octalactone |
MF |
C8H14O2 |
Berat Molekul |
142.1956 |
InChI |
InChI=1/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
CAS NO |
698-76-0 |
EINECS |
211-820-5 |
Struktur Molekul |
|
Kepadatan |
0.96g/cm3 |
Titik didih |
239.8°C at 760 mmHg |
Indeks bias |
1.436 |
Titik nyala |
92.2°C |
Tekanan uap |
0.0394mmHg at 25°C |
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|