ChemNet > CAS > 89466-08-0 2-Hydroxybenzeneboronic acid
89466-08-0 2-Hydroxybenzeneboronic acid
Nama produk |
2-Hydroxybenzeneboronic acid |
Nama bahasa Inggris |
2-Hydroxybenzeneboronic acid; 2-Boronophenol; 2-Hydroxyphenylboronic acid |
MF |
C6H7BO3 |
Berat Molekul |
137.929 |
InChI |
InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
CAS NO |
89466-08-0 |
Struktur Molekul |
|
Kepadatan |
1.32g/cm3 |
Titik didih |
327.3°C at 760 mmHg |
Indeks bias |
1.582 |
Titik nyala |
151.7°C |
Tekanan uap |
8.28E-05mmHg at 25°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|