ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
שם המוצר |
Pentamethylphenylacetonitrile |
שם אנגלי |
Pentamethylphenylacetonitrile; 2,3,4,5,6-Pentamethylbenzyl cyanide |
מולקולרית פורמולה |
C13H17N |
משקל מולקולרי |
187.2808 |
InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
מספר CAS |
34688-70-5 |
מבנה מולקולרי |
|
צפיפות |
0.95g/cm3 |
נקודת ההתוך |
105-107℃ |
נקודת רתיחה |
325.9°C at 760 mmHg |
משקל סגולי |
1.519 |
נקודת הבזק |
160.2°C |
לחץ אדים |
0.000224mmHg at 25°C |
סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|