ChemNet > CAS > 1752-30-3 acetone thiosemicarbazone
1752-30-3 acetone thiosemicarbazone
| उत्पाद का नाम |
acetone thiosemicarbazone |
| अंग्रेजी नाम |
acetone thiosemicarbazone; ATSC; propan-2-one thiosemicarbazone; Acetorme thios emicarbazone |
| आणविक फार्मूला |
C4H9N3S |
| आण्विक वजन |
131.1994 |
| InChI |
InChI=1/C4H9N3S/c1-3(2)6-7-4(5)8/h1-2H3,(H3,5,7,8) |
| कैस रजिस्टी संख्या |
1752-30-3 |
| EINECS |
217-137-9 |
| आणविक संरचना |
|
| घनत्व |
1.19g/cm3 |
| उबलने का समय |
213.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.569 |
| फ्लैश प्वाइंट |
83.1°C |
| वाष्प का दबाव |
0.161mmHg at 25°C |
| खतरे के कोड |
R21:Harmful in contact with skin.;
R25:Toxic if swallowed.;
R26:Very toxic by inhalation.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|