ChemNet > CAS > 1752-30-3 acetone thiosemicarbazone
1752-30-3 acetone thiosemicarbazone
| Nazwa produktu: |
acetone thiosemicarbazone |
| Synonimy |
ATSC; propan-2-one thiosemicarbazone; Acetorme thios emicarbazone |
| MF |
C4H9N3S |
| Masie cząsteczkowej |
131.1994 |
| InChI |
InChI=1/C4H9N3S/c1-3(2)6-7-4(5)8/h1-2H3,(H3,5,7,8) |
| Nr CAS |
1752-30-3 |
| EINECS |
217-137-9 |
| Struktury molekularnej |
|
| Gęstość |
1.19g/cm3 |
| Temperatura wrzenia |
213.8°C at 760 mmHg |
| Współczynnik załamania |
1.569 |
| Temperatura zapłonu |
83.1°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R21:Harmful in contact with skin.;
R25:Toxic if swallowed.;
R26:Very toxic by inhalation.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
