ChemNet > CAS > 2050-23-9 Diethyl suberate
2050-23-9 Diethyl suberate
| उत्पाद का नाम |
Diethyl suberate |
| समानार्थी |
Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| आणविक फार्मूला |
C12H22O4 |
| आण्विक वजन |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| कैस रजिस्टी संख्या |
2050-23-9 |
| EINECS |
218-084-4 |
| आणविक संरचना |
|
| घनत्व |
0.985g/cm3 |
| गलनांक |
5-284℃ |
| उबलने का समय |
282.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.436 |
| फ्लैश प्वाइंट |
123.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
