ChemNet > CAS > 243863-36-7 2-(difluoromethoxy)benzylamine
243863-36-7 2-(difluoromethoxy)benzylamine
उत्पाद का नाम |
2-(difluoromethoxy)benzylamine |
समानार्थी |
1-[2-(difluoromethoxy)phenyl]methanamine |
आणविक फार्मूला |
C8H9F2NO |
आण्विक वजन |
173.16 |
InChI |
InChI=1/C8H9F2NO/c9-8(10)12-7-4-2-1-3-6(7)5-11/h1-4,8H,5,11H2 |
कैस रजिस्टी संख्या |
243863-36-7 |
आणविक संरचना |
|
घनत्व |
1.196g/cm3 |
उबलने का समय |
214.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.487 |
फ्लैश प्वाइंट |
83.3°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|