ChemNet > CAS > 570-08-1 Diethyl acetylmalonate
570-08-1 Diethyl acetylmalonate
उत्पाद का नाम |
Diethyl acetylmalonate |
समानार्थी |
Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate |
आणविक फार्मूला |
C9H12O5 |
आण्विक वजन |
200.1897 |
InChI |
InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2 |
कैस रजिस्टी संख्या |
570-08-1 |
आणविक संरचना |
|
उबलने का समय |
372.3°C at 760 mmHg |
फ्लैश प्वाइंट |
193.1°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|