ChemNet > CAS > 570-08-1 Diethyl acetylmalonate
570-08-1 Diethyl acetylmalonate
상품명칭 |
Diethyl acetylmalonate |
별명 |
Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate |
분자식 |
C9H12O5 |
분자량 |
200.1897 |
InChI |
InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2 |
cas번호 |
570-08-1 |
분자 구조 |
|
비등점 |
372.3°C at 760 mmHg |
인화점 |
193.1°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|