ChemNet > CAS > 622-52-6 P-Tolylthiourea
622-52-6 P-Tolylthiourea
उत्पाद का नाम |
P-Tolylthiourea |
समानार्थी |
4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
आणविक फार्मूला |
C8H10N2S |
आण्विक वजन |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
कैस रजिस्टी संख्या |
622-52-6 |
EINECS |
210-740-8 |
आणविक संरचना |
|
घनत्व |
1.242g/cm3 |
उबलने का समय |
282.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.696 |
फ्लैश प्वाइंट |
124.6°C |
खतरा प्रतीक |
|
खतरे के कोड |
R25:Toxic if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|