622-52-6 P-Tolylthiourea
Nome del prodotto |
P-Tolylthiourea |
Nome inglese |
P-Tolylthiourea; 4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
Formula molecolare |
C8H10N2S |
Peso Molecolare |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
Numero CAS |
622-52-6 |
EINECS |
210-740-8 |
Struttura molecolare |
|
Densità |
1.242g/cm3 |
Punto di ebollizione |
282.5°C at 760 mmHg |
Indice di rifrazione |
1.696 |
Punto d'infiammabilità |
124.6°C |
Pressione di vapore |
0.00335mmHg at 25°C |
Codici di Rischio |
R25:Toxic if swallowed.;
|
Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|