ChemNet > CAS > 91367-05-4 Methyl 4-chloro-3-methylbenzoate
91367-05-4 Methyl 4-chloro-3-methylbenzoate
उत्पाद का नाम |
Methyl 4-chloro-3-methylbenzoate |
अंग्रेजी नाम |
Methyl 4-chloro-3-methylbenzoate; 4-Chloro-3-methylbenzoic acid methyl ester~4-Chloro-m-toluic acid methyl ester |
आणविक फार्मूला |
C9H9ClO2 |
आण्विक वजन |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-6-5-7(9(11)12-2)3-4-8(6)10/h3-5H,1-2H3 |
कैस रजिस्टी संख्या |
91367-05-4 |
आणविक संरचना |
|
घनत्व |
1.186g/cm3 |
उबलने का समय |
247°C at 760 mmHg |
अपवर्तक सूचकांक |
1.525 |
फ्लैश प्वाइंट |
113.6°C |
वाष्प का दबाव |
0.0263mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|