ChemNet > CAS > 91367-05-4 Methyl 4-chloro-3-methylbenzoate
91367-05-4 Methyl 4-chloro-3-methylbenzoate
Nama produk |
Methyl 4-chloro-3-methylbenzoate |
Sinonim |
4-Chloro-3-methylbenzoic acid methyl ester~4-Chloro-m-toluic acid methyl ester |
MF |
C9H9ClO2 |
Berat Molekul |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-6-5-7(9(11)12-2)3-4-8(6)10/h3-5H,1-2H3 |
CAS NO |
91367-05-4 |
Struktur Molekul |
|
Kepadatan |
1.186g/cm3 |
Titik didih |
247°C at 760 mmHg |
Indeks bias |
1.525 |
Titik nyala |
113.6°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|