ChemNet > CAS > 937-63-3 p-Tolyl chlorothionoformate
937-63-3 p-Tolyl chlorothionoformate
उत्पाद का नाम |
p-Tolyl chlorothionoformate |
समानार्थी |
p-Tolyl chlorothioformate; O-(4-methylphenyl) carbonochloridothioate |
आणविक फार्मूला |
C8H7ClOS |
आण्विक वजन |
186.6586 |
InChI |
InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
कैस रजिस्टी संख्या |
937-63-3 |
EINECS |
213-333-3 |
आणविक संरचना |
|
घनत्व |
1.277g/cm3 |
उबलने का समय |
244.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.598 |
फ्लैश प्वाइंट |
101.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|