ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
उत्पाद का नाम |
2-Methyl-5-nitrobenzonitrile |
अंग्रेजी नाम |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
आणविक फार्मूला |
C8H6N2O2 |
आण्विक वजन |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
कैस रजिस्टी संख्या |
939-83-3 |
आणविक संरचना |
|
घनत्व |
1.26g/cm3 |
गलनांक |
103.5-107.5℃ |
उबलने का समय |
291.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.568 |
फ्लैश प्वाइंट |
130.1°C |
वाष्प का दबाव |
0.00194mmHg at 25°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|