ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
اسم المنتج |
2-Methyl-5-nitrobenzonitrile |
الاسم بالانجليزية |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
الصيغة الجزيئية |
C8H6N2O2 |
الوزن الجزيئي الغرامي |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
939-83-3 |
بنية جزيئية |
|
كثافة |
1.26g/cm3 |
درجة الإنصهار |
103.5-107.5℃ |
نقطة الغليان |
291.5°C at 760 mmHg |
معامل الإنكسار |
1.568 |
نقطة الوميض |
130.1°C |
ضغط البخار |
0.00194mmHg at 25°C |
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|