ChemNet > CAS > 1011-92-3 alpha-cyanocinnamic acid
1011-92-3 alpha-cyanocinnamic acid
نام محصول |
alpha-cyanocinnamic acid |
نام انگلیسی |
alpha-cyanocinnamic acid; Cyanocinnamicacid; (2E)-2-cyano-3-phenylprop-2-enoic acid; (2Z)-2-cyano-3-phenylprop-2-enoic acid; (2E)-2-cyano-3-phenylprop-2-enoate |
میدان مغناطیسی |
C10H6NO2 |
وزن مولکولی |
172.1607 |
InChI |
InChI=1/C10H7NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-6H,(H,12,13)/p-1/b9-6+ |
شماره سیایاس |
1011-92-3 |
تعداد کمیسیون اروپایی |
213-788-8 |
ساختار مولکولی |
|
نقطه غلیان |
337.9°C at 760 mmHg |
نقطه اشتعال |
158.1°C |
فشار بخار |
3.98E-05mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|