ChemNet > CAS > 1011-92-3 alpha-cyanocinnamic acid
1011-92-3 alpha-cyanocinnamic acid
Nama produk |
alpha-cyanocinnamic acid |
Sinonim |
Cyanocinnamicacid; (2E)-2-cyano-3-phenylprop-2-enoic acid; (2Z)-2-cyano-3-phenylprop-2-enoic acid; (2E)-2-cyano-3-phenylprop-2-enoate |
MF |
C10H6NO2 |
Berat Molekul |
172.1607 |
InChI |
InChI=1/C10H7NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-6H,(H,12,13)/p-1/b9-6+ |
CAS NO |
1011-92-3 |
EINECS |
213-788-8 |
Struktur Molekul |
|
Titik didih |
337.9°C at 760 mmHg |
Titik nyala |
158.1°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|