ChemNet > CAS > 1147-65-5 (2-Carboxyphenyl)iminodiacetic acid
1147-65-5 (2-Carboxyphenyl)iminodiacetic acid
نام محصول |
(2-Carboxyphenyl)iminodiacetic acid |
مترادف |
N,N-Bis(carboxymethyl)anthranilic acid; 2-[bis(carboxymethyl)amino]benzoic acid |
میدان مغناطیسی |
C11H11NO6 |
وزن مولکولی |
253.2081 |
InChI |
InChI=1/C11H11NO6/c13-9(14)5-12(6-10(15)16)8-4-2-1-3-7(8)11(17)18/h1-4H,5-6H2,(H,13,14)(H,15,16)(H,17,18) |
شماره سیایاس |
1147-65-5 |
ساختار مولکولی |
|
تراکم |
1.56g/cm3 |
نقطه غلیان |
560.9°C at 760 mmHg |
ضریب شکست |
1.66 |
نقطه اشتعال |
293°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|