ChemNet > CAS > 173550-97-5 Terephthalic acid mono(2-bromoethyl) ester
173550-97-5 Terephthalic acid mono(2-bromoethyl) ester
نام محصول |
Terephthalic acid mono(2-bromoethyl) ester |
نام انگلیسی |
Terephthalic acid mono(2-bromoethyl) ester; 2-Bromoethyl hydrogen terephthalate; 4-[(2-bromoethoxy)carbonyl]benzoic acid |
میدان مغناطیسی |
C10H9BrO4 |
وزن مولکولی |
273.0801 |
InChI |
InChI=1/C10H9BrO4/c11-5-6-15-10(14)8-3-1-7(2-4-8)9(12)13/h1-4H,5-6H2,(H,12,13) |
شماره سیایاس |
173550-97-5 |
ساختار مولکولی |
|
تراکم |
1.61g/cm3 |
نقطه غلیان |
412.8°C at 760 mmHg |
ضریب شکست |
1.591 |
نقطه اشتعال |
203.5°C |
فشار بخار |
1.48E-07mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|