ChemNet > CAS > 173550-97-5 Terephthalic acid mono(2-bromoethyl) ester
173550-97-5 Terephthalic acid mono(2-bromoethyl) ester
Nazwa produktu: |
Terephthalic acid mono(2-bromoethyl) ester |
Angielska nazwa |
Terephthalic acid mono(2-bromoethyl) ester; 2-Bromoethyl hydrogen terephthalate; 4-[(2-bromoethoxy)carbonyl]benzoic acid |
MF |
C10H9BrO4 |
Masie cząsteczkowej |
273.0801 |
InChI |
InChI=1/C10H9BrO4/c11-5-6-15-10(14)8-3-1-7(2-4-8)9(12)13/h1-4H,5-6H2,(H,12,13) |
Nr CAS |
173550-97-5 |
Struktury molekularnej |
|
Gęstość |
1.61g/cm3 |
Temperatura wrzenia |
412.8°C at 760 mmHg |
Współczynnik załamania |
1.591 |
Temperatura zapłonu |
203.5°C |
Ciśnienie pary |
1.48E-07mmHg at 25°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|