ChemNet > CAS > 175204-06-5 2-Fluoro-6-phenoxybenzonitrile
175204-06-5 2-Fluoro-6-phenoxybenzonitrile
نام محصول |
2-Fluoro-6-phenoxybenzonitrile |
نام انگلیسی |
2-Fluoro-6-phenoxybenzonitrile; 2-Fluoro-6-phenyloxybenzonitrile |
میدان مغناطیسی |
C13H8FNO |
وزن مولکولی |
213.2071 |
InChI |
InChI=1/C13H8FNO/c14-12-7-4-8-13(11(12)9-15)16-10-5-2-1-3-6-10/h1-8H |
شماره سیایاس |
175204-06-5 |
ساختار مولکولی |
|
تراکم |
1.24g/cm3 |
نقطه ذوب |
90-93℃ |
نقطه غلیان |
308.5°C at 760 mmHg |
ضریب شکست |
1.591 |
نقطه اشتعال |
140.4°C |
فشار بخار |
0.000678mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|