ChemNet > CAS > 175204-06-5 2-Fluoro-6-phenoxybenzonitrile
175204-06-5 2-Fluoro-6-phenoxybenzonitrile
Nazwa produktu: |
2-Fluoro-6-phenoxybenzonitrile |
Angielska nazwa |
2-Fluoro-6-phenoxybenzonitrile; 2-Fluoro-6-phenyloxybenzonitrile |
MF |
C13H8FNO |
Masie cząsteczkowej |
213.2071 |
InChI |
InChI=1/C13H8FNO/c14-12-7-4-8-13(11(12)9-15)16-10-5-2-1-3-6-10/h1-8H |
Nr CAS |
175204-06-5 |
Struktury molekularnej |
|
Gęstość |
1.24g/cm3 |
Temperatura topnienia |
90-93℃ |
Temperatura wrzenia |
308.5°C at 760 mmHg |
Współczynnik załamania |
1.591 |
Temperatura zapłonu |
140.4°C |
Ciśnienie pary |
0.000678mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|