ChemNet > CAS > 183158-34-1 2,3-Dimethylbenzeneboronic acid
183158-34-1 2,3-Dimethylbenzeneboronic acid
نام محصول |
2,3-Dimethylbenzeneboronic acid |
نام انگلیسی |
2,3-Dimethylbenzeneboronic acid; 2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
میدان مغناطیسی |
C8H11BO2 |
وزن مولکولی |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
شماره سیایاس |
183158-34-1 |
ساختار مولکولی |
|
تراکم |
1.07g/cm3 |
نقطه ذوب |
174-180℃ |
نقطه غلیان |
312.6°C at 760 mmHg |
ضریب شکست |
1.523 |
نقطه اشتعال |
142.8°C |
فشار بخار |
0.000224mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|