ChemNet > CAS > 19437-26-4 Di-2-pyridyl ketone
19437-26-4 Di-2-pyridyl ketone
| نام محصول |
Di-2-pyridyl ketone |
| مترادف |
Dipyridylketone; Di(2-pyridyl)ketone; dipyridin-2-ylmethanone |
| میدان مغناطیسی |
C11H8N2O |
| وزن مولکولی |
184.194 |
| InChI |
InChI=1/C11H8N2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-8H |
| شماره سیایاس |
19437-26-4 |
| تعداد کمیسیون اروپایی |
243-067-3 |
| ساختار مولکولی |
|
| تراکم |
1.196g/cm3 |
| نقطه ذوب |
52-55℃ |
| نقطه غلیان |
343.5°C at 760 mmHg |
| ضریب شکست |
1.593 |
| نقطه اشتعال |
165.7°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
