ChemNet > CAS > 19437-26-4 Di-2-pyridyl ketone
19437-26-4 Di-2-pyridyl ketone
Naam product |
Di-2-pyridyl ketone |
Synoniemen |
Dipyridylketone; Di(2-pyridyl)ketone; dipyridin-2-ylmethanone |
MF |
C11H8N2O |
Molecuulgewicht |
184.194 |
InChI |
InChI=1/C11H8N2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-8H |
CAS-nummer |
19437-26-4 |
EINECS |
243-067-3 |
Moleculaire Structuur |
|
Dichtheid |
1.196g/cm3 |
Smeltpunt |
52-55℃ |
Kookpunt |
343.5°C at 760 mmHg |
Brekingsindex |
1.593 |
Vlampunt |
165.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|