ChemNet > CAS > 3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
نام محصول |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one |
نام انگلیسی |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one; 1-(3,4-dimethoxyphenyl)-2-phenylethanone |
میدان مغناطیسی |
C16H16O3 |
وزن مولکولی |
256.2964 |
InChI |
InChI=1/C16H16O3/c1-18-15-9-8-13(11-16(15)19-2)14(17)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
شماره سیایاس |
3141-93-3 |
ساختار مولکولی |
|
تراکم |
1.115g/cm3 |
نقطه ذوب |
87℃ |
نقطه غلیان |
398°C at 760 mmHg |
ضریب شکست |
1.558 |
نقطه اشتعال |
186.1°C |
فشار بخار |
1.53E-06mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|