ChemNet > CAS > 3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
اسم المنتج |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one |
الاسم بالانجليزية |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one; 1-(3,4-dimethoxyphenyl)-2-phenylethanone |
الصيغة الجزيئية |
C16H16O3 |
الوزن الجزيئي الغرامي |
256.2964 |
InChI |
InChI=1/C16H16O3/c1-18-15-9-8-13(11-16(15)19-2)14(17)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
إستراتيجية المساعدة القطرية |
3141-93-3 |
بنية جزيئية |
|
كثافة |
1.115g/cm3 |
درجة الإنصهار |
87℃ |
نقطة الغليان |
398°C at 760 mmHg |
معامل الإنكسار |
1.558 |
نقطة الوميض |
186.1°C |
ضغط البخار |
1.53E-06mmHg at 25°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|