ChemNet > CAS > 374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
نام محصول |
4-Bromo-2,3-difluorobenzeneboronic acid |
نام انگلیسی |
4-Bromo-2,3-difluorobenzeneboronic acid; 4-Bromo-2,3-difluorophenylboronic acid |
میدان مغناطیسی |
C6H4BBrF2O2 |
وزن مولکولی |
236.8066 |
InChI |
InChI=1/C6H4BBrF2O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
شماره سیایاس |
374790-99-5 |
ساختار مولکولی |
|
تراکم |
1.82g/cm3 |
نقطه غلیان |
312.6°C at 760 mmHg |
ضریب شکست |
1.547 |
نقطه اشتعال |
142.8°C |
فشار بخار |
0.000224mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|