ChemNet > CAS > 374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
374790-99-5 4-Bromo-2,3-difluorobenzeneboronic acid
Nama produk |
4-Bromo-2,3-difluorobenzeneboronic acid |
Nama Inggeris |
4-Bromo-2,3-difluorobenzeneboronic acid; 4-Bromo-2,3-difluorophenylboronic acid |
MF |
C6H4BBrF2O2 |
Berat Molekul |
236.8066 |
InChI |
InChI=1/C6H4BBrF2O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
CAS NO |
374790-99-5 |
Struktur Molekul |
|
Kepadatan |
1.82g/cm3 |
Titik didih |
312.6°C at 760 mmHg |
Indeks bias |
1.547 |
Titik nyala |
142.8°C |
Tekanan wap |
0.000224mmHg at 25°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|