ChemNet > CAS > 4521-33-9 5-Nitrothiophene-2-carboxaldehyde
4521-33-9 5-Nitrothiophene-2-carboxaldehyde
نام محصول |
5-Nitrothiophene-2-carboxaldehyde |
نام انگلیسی |
5-Nitrothiophene-2-carboxaldehyde;5-Nitrothiophene-2-carbaldehyde |
میدان مغناطیسی |
C5H3NO3S |
وزن مولکولی |
157.1472 |
InChI |
InChI=1/C5H3NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
شماره سیایاس |
4521-33-9 |
تعداد کمیسیون اروپایی |
224-850-9 |
ساختار مولکولی |
|
تراکم |
1.534g/cm3 |
نقطه غلیان |
297.2°C at 760 mmHg |
ضریب شکست |
1.662 |
نقطه اشتعال |
133.5°C |
فشار بخار |
0.00137mmHg at 25°C |
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|